3,4,5-Trimethoxyphenylacetic acid structure
|
Common Name | 3,4,5-Trimethoxyphenylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 951-82-6 | Molecular Weight | 226.226 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 360.8±37.0 °C at 760 mmHg | |
| Molecular Formula | C11H14O5 | Melting Point | 117-120 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 138.1±20.0 °C | |
Use of 3,4,5-Trimethoxyphenylacetic acid3,4,5-Trimethoxyphenylacetic acid is a metabolite of Mescaline[1]. |
| Name | 3,4,5-Trimethoxyphenylacetic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 3,4,5-Trimethoxyphenylacetic acid is a metabolite of Mescaline[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 360.8±37.0 °C at 760 mmHg |
| Melting Point | 117-120 °C(lit.) |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.226 |
| Flash Point | 138.1±20.0 °C |
| Exact Mass | 226.084122 |
| PSA | 64.99000 |
| LogP | 0.94 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.520 |
| InChIKey | DDSJXCGGOXKGSJ-UHFFFAOYSA-N |
| SMILES | COc1cc(CC(=O)O)cc(OC)c1OC |
| Water Solubility | SOLUBLE |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R38 |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 29189090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Bacterial degradation of 3,4,5-trimethoxyphenylacetic and 3-ketoglutaric acids.
J. Bacteriol. 147(2) , 477-81, (1981) When grown at the expense of 3,4,5-trimethoxyphenylacetic acid, a species of Arthrobacter readily oxidized 3,4-dihydroxy-5-methoxyphenylacetic acid, but other structurally related aromatic acids were ... |
| EINECS 213-456-2 |
| 3,4,5-Trimethoxyphenylacetic acid |
| (3,4,5-Trimethoxyphenyl)acetic acid |
| 2-(3,4,5-trimethoxyphenyl)acetic acid |
| MFCD00004336 |
| Benzeneacetic acid, 3,4,5-trimethoxy- |