VARIAMINE BLUE B BASE
VARIAMINE BLUE B BASE structure
|
Common Name | VARIAMINE BLUE B BASE | ||
|---|---|---|---|---|
| CAS Number | 101-64-4 | Molecular Weight | 214.26300 | |
| Density | 1.178g/cm3 | Boiling Point | 210ºC / 4mmHg | |
| Molecular Formula | C13H14N2O | Melting Point | 101ºC | |
| MSDS | N/A | Flash Point | 188.9ºC | |
Summary: 4-Amino-4’-methoxydiphenylamine (variamine blue b base, Chinese name: 4-Amino-4’-methoxydiphenylamine) has a CAS number of 101-64-4, with a molecular formula of C13H14N2O and a molecular weight of 214.26300. It appears as blue-gray to black crystals or powder, with a melting point of 101°C and a boiling point of 210°C/4mmHg. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | variamine blue b base |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.178g/cm3 |
|---|---|
| Boiling Point | 210ºC / 4mmHg |
| Melting Point | 101ºC |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.26300 |
| Flash Point | 188.9ºC |
| Exact Mass | 214.11100 |
| PSA | 47.28000 |
| LogP | 3.67520 |
| Vapour Pressure | 3.01E-06mmHg at 25°C |
| Index of Refraction | 1.653 |
| InChIKey | RBLUJIWKMSZIMK-UHFFFAOYSA-N |
| SMILES | COc1ccc(Nc2ccc(N)cc2)cc1 |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Risk Phrases | 20/21/22-36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 2811 |
| Packaging Group | II |
| Hazard Class | 6.1(a) |
| HS Code | 2922299090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 5 | |
CAS#:7696-66-4
CAS#:41018-73-9
CAS#:2101-87-3
CAS#:100-17-4
CAS#:100033-67-8
CAS#:730-11-0
CAS#:33836-66-7
CAS#:63235-31-4
CAS#:16078-86-7
CAS#:350-46-9
CAS#:27163-30-0
CAS#:33840-14-1
CAS#:67979-39-9
CAS#:54480-44-3This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-(4-aminophenyl)-p-anisidine |
| Variamine Blue B Base [Redox Indicator] |
| C.I.Azoic Diazo Component 35(base) |
| MFCD00070553 |
| N-(4-methoxyphenyl)-p-phenylenediamine |
| N-(4-aminophenyl)-N-(4-methoxyphenyl)amine |
| N-(4-methoxyphenyl)-1,4-phenylendiamine |
| VariaMine Blue B Base Diazol Blue O |
| N-(p-methoxyphenyl)-p-phenylenediamine |
| AURORA KA-7508 |
| 4-Amino-4'-methoxydiphenylamine |
| n-(4-methoxyphenyl)-4-benzenediamine |
| N-(4-Methoxyphenyl)-1,4-phenylenediamine |
| 4-methoxy-4'-aminodiphenylamine |
| EINECS 202-962-9 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the melting point of variamine blue b base? |
| A: Melting point of variamine blue b base is 101ºC. |
| Q: What is the polar surface area (PSA) of variamine blue b base? |
| A: Polar surface area (PSA) of variamine blue b base is 47.28000. |
| Q: What is the CAS number of variamine blue b base? |
| A: CAS number of variamine blue b base is 101-64-4. |
| Q: What is the SMILES notation of variamine blue b base? |
| A: SMILES notation of variamine blue b base is COc1ccc(Nc2ccc(N)cc2)cc1. |
| Q: What is the English name of variamine blue b base? |
| A: The English name of variamine blue b base is variamine blue b base. |
| Q: What are the upstream materials of variamine blue b base? |
| A: Related upstream materials(CAS) of variamine blue b base: 7696-66-4;41018-73-9;2101-87-3;100-17-4;100033-67-8;730-11-0;33836-66-7;63235-31-4;16078-86-7. |
| Q: What is the LogP of variamine blue b base? |
| A: LogP of variamine blue b base is 3.67520. |
| Q: What is the safety information for variamine blue b base? |
| A: Safety information for variamine blue b base: 26-36/37/39. |
| Q: What is the molecular formula of variamine blue b base? |
| A: Molecular formula of variamine blue b base is C13H14N2O. |
| Q: What is the boiling point of variamine blue b base? |
| A: Boiling point of variamine blue b base is 210ºC / 4mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |