4,4'-Dimethoxydiphenylamine structure
|
Common Name | 4,4'-Dimethoxydiphenylamine | ||
|---|---|---|---|---|
| CAS Number | 101-70-2 | Molecular Weight | 229.274 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 371.1±27.0 °C at 760 mmHg | |
| Molecular Formula | C14H15NO2 | Melting Point | 101-102°C | |
| MSDS | Chinese USA | Flash Point | 150.5±13.2 °C | |
| Symbol |
GHS07, GHS08 |
Signal Word | Warning | |
| Name | Bis(4-methoxyphenyl)amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 371.1±27.0 °C at 760 mmHg |
| Melting Point | 101-102°C |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.274 |
| Flash Point | 150.5±13.2 °C |
| Exact Mass | 229.110275 |
| PSA | 30.49000 |
| LogP | 2.87 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | VCOONNWIINSFBA-UHFFFAOYSA-N |
| SMILES | COc1ccc(Nc2ccc(OC)cc2)cc1 |
| Stability | Stability Combustible. Incompatible with strong oxidizing agents. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335-H351 |
| Precautionary Statements | P261-P281-P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | R68 |
| Safety Phrases | S22-S36/37/39 |
| RIDADR | NONH for all modes of transport |
| RTECS | DU9085000 |
| HS Code | 2922299090 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Thermally stable triaryl amino chromophores with high molecular hyperpolarizabilities Spraul, Bryan K., et al.
Tetrahedron Lett. 45(16) , 3253-3256, (2004)
|
|
|
Triarylene linked spacer effect for dye-sensitized solar cells Chang, Y. J., Wu, Y. J., Chou, P. T., Watanabe, M., & Chow, T. J.
Thin Solid Films 558 , 330-336, (2014)
|
| 4-Methoxy-N-(4-methoxyphenyl)aniline |
| Bis-(4-methoxy-phenyl)-amine |
| Di-p-anisylamine |
| EINECS 202-968-1 |
| Benzenamine, 4-methoxy-N-(4-methoxyphenyl)- |
| 4,4'-Dimethoxydiphenylamine |
| MFCD00014895 |