ci 37210
ci 37210 structure
|
Common Name | ci 37210 | ||
|---|---|---|---|---|
| CAS Number | 101-89-3 | Molecular Weight | 334.350 | |
| Density | 1.3798 (rough estimate) | Boiling Point | N/A | |
| Molecular Formula | C14H14N4O4S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS08 |
Signal Word | Danger | |
Summary: Solid Scarlet GBC (hydrogen sulfate,2-methyl-4-[(2-methylphenyl)diazenyl]benzenediazonium, CAS No. 101-89-3) is a rust brown to brown powder with a molecular formula of C14H14N4O4S and a molecular weight of 334.350. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | hydrogen sulfate,2-methyl-4-[(2-methylphenyl)diazenyl]benzenediazonium |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.3798 (rough estimate) |
|---|---|
| Molecular Formula | C14H14N4O4S |
| Molecular Weight | 334.350 |
| Exact Mass | 334.073578 |
| PSA | 138.68000 |
| LogP | 5.28878 |
| Index of Refraction | 1.6270 (estimate) |
| InChIKey | PPTXFSQSISUDAU-UHFFFAOYSA-M |
| SMILES | Cc1ccccc1N=Nc1ccc([N+]#N)c(C)c1.O=S(=O)([O-])O |
| Storage condition | −20°C |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H350 |
| Precautionary Statements | P201-P308 + P313 |
| Personal Protective Equipment | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | T: Toxic; |
| Risk Phrases | R45 |
| Safety Phrases | 53-45-36/37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
This table lists relevant public references with title, journal and publication metadata for this compound.
|
Human stefin B role in cell's response to misfolded proteins and autophagy.
PLoS ONE 9(7) , e102500, (2014) Alternative functions, apart from cathepsins inhibition, are being discovered for stefin B. Here, we investigate its role in vesicular trafficking and autophagy. Astrocytes isolated from stefin B knoc... |
|
|
Differences in copper bioaccumulation and biological responses in three Mytilus species.
Aquat. Toxicol. 160 , 1-12, (2015) Mytilus species are important organisms in marine systems being highly abundant and widely distributed along the coast of Europe and worldwide. They are typically used in biological effects studies an... |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Methyl-4-([2-methylphenyl]azo)benzenediazonium salt |
| EINECS 202-985-4 |
| Fast Garnet GBC |
| 2-Methyl-4-[(E)-(2-methylphenyl)diazenyl]benzenediazonium hydrogen sulfate |
| Fast Garnet GBC sulfate salt |
| Azoic Diazo No. 4 |
| Benzenediazonium,2-methyl-4-((2-methylphenyl)azo)-,sulfate (1:1) |
| Fast Garnet GBC Salt |
| MFCD00011883 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the safety information for hydrogen sulfate,2-methyl-4-[(2-methylphenyl)diazenyl]benzenediazonium? |
| A: Safety information for hydrogen sulfate,2-methyl-4-[(2-methylphenyl)diazenyl]benzenediazonium: 53-45-36/37/39. |
| Q: What is the CAS number of hydrogen sulfate,2-methyl-4-[(2-methylphenyl)diazenyl]benzenediazonium? |
| A: CAS number of hydrogen sulfate,2-methyl-4-[(2-methylphenyl)diazenyl]benzenediazonium is 101-89-3. |
| Q: What is the molecular weight of hydrogen sulfate,2-methyl-4-[(2-methylphenyl)diazenyl]benzenediazonium? |
| A: Molecular weight of hydrogen sulfate,2-methyl-4-[(2-methylphenyl)diazenyl]benzenediazonium is 334.350. |
| Q: What English synonyms does hydrogen sulfate,2-methyl-4-[(2-methylphenyl)diazenyl]benzenediazonium have? |
| A: English synonyms of hydrogen sulfate,2-methyl-4-[(2-methylphenyl)diazenyl]benzenediazonium: 2-Methyl-4-([2-methylphenyl]azo)benzenediazonium salt, EINECS 202-985-4, Fast Garnet GBC, 2-Methyl-4-[(E)-(2-methylphenyl)diazenyl]benzenediazonium hydrogen sulfate, Fast Garnet GBC sulfate salt, Azoic Diazo No. 4, Benzenediazonium,2-methyl-4-((2-methylphenyl)azo)-,sulfate (1:1), Fast Garnet GBC Salt, MFCD00011883. |
| Q: What are the storage conditions for hydrogen sulfate,2-methyl-4-[(2-methylphenyl)diazenyl]benzenediazonium? |
| A: Storage conditions for hydrogen sulfate,2-methyl-4-[(2-methylphenyl)diazenyl]benzenediazonium: −20°C. |
| Q: What is the SMILES notation of hydrogen sulfate,2-methyl-4-[(2-methylphenyl)diazenyl]benzenediazonium? |
| A: SMILES notation of hydrogen sulfate,2-methyl-4-[(2-methylphenyl)diazenyl]benzenediazonium is Cc1ccccc1N=Nc1ccc([N+]#N)c(C)c1.O=S(=O)([O-])O. |
| Q: What is the English name of hydrogen sulfate,2-methyl-4-[(2-methylphenyl)diazenyl]benzenediazonium? |
| A: The English name of hydrogen sulfate,2-methyl-4-[(2-methylphenyl)diazenyl]benzenediazonium is hydrogen sulfate,2-methyl-4-[(2-methylphenyl)diazenyl]benzenediazonium. |
| Q: What is the polar surface area (PSA) of hydrogen sulfate,2-methyl-4-[(2-methylphenyl)diazenyl]benzenediazonium? |
| A: Polar surface area (PSA) of hydrogen sulfate,2-methyl-4-[(2-methylphenyl)diazenyl]benzenediazonium is 138.68000. |
| Q: What is the InChIKey of hydrogen sulfate,2-methyl-4-[(2-methylphenyl)diazenyl]benzenediazonium? |
| A: InChIKey of hydrogen sulfate,2-methyl-4-[(2-methylphenyl)diazenyl]benzenediazonium is PPTXFSQSISUDAU-UHFFFAOYSA-M. |
| Q: What is the molecular formula of hydrogen sulfate,2-methyl-4-[(2-methylphenyl)diazenyl]benzenediazonium? |
| A: Molecular formula of hydrogen sulfate,2-methyl-4-[(2-methylphenyl)diazenyl]benzenediazonium is C14H14N4O4S. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |