Fluorescent DOTAP structure
|
Common Name | Fluorescent DOTAP | ||
|---|---|---|---|---|
| CAS Number | 1010076-97-7 | Molecular Weight | 710.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H60ClN5O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fluorescent DOTAPFluorescent DOTAP, a cationic lipid, can be used for the research of nucleic acid and protein delivery[1]. |
| Name | Fluorescent DOTAP |
|---|
| Description | Fluorescent DOTAP, a cationic lipid, can be used for the research of nucleic acid and protein delivery[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C36H60ClN5O7 |
|---|---|
| Molecular Weight | 710.34 |
| InChIKey | XDKRQAPVOCOOGF-USGGBSEESA-M |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(C[N+](C)(C)C)OC(=O)CCCCCNc1ccc([N+](=O)[O-])c2nonc12.[Cl-] |