(S)-tert-Butyl 3-(piperazin-1-yl)pyrrolidine-1-carboxylate structure
|
Common Name | (S)-tert-Butyl 3-(piperazin-1-yl)pyrrolidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1010446-31-7 | Molecular Weight | 255.357 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 354.3±37.0 °C at 760 mmHg | |
| Molecular Formula | C13H25N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.1±26.5 °C | |
| Name | (S)-3-piperazin-1-yl-pyrrolidine-1-carboxylic acid tert-butyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 354.3±37.0 °C at 760 mmHg |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.357 |
| Flash Point | 168.1±26.5 °C |
| Exact Mass | 255.194672 |
| PSA | 44.81000 |
| LogP | 0.46 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.512 |
| InChIKey | HCNFKJFDUHUDTA-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(N2CCNCC2)C1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl-2-propanyl 3-(1-piperazinyl)-1-pyrrolidinecarboxylate |
| (S)-tert-butyl 3-(piperazin-1-yl) pyrrolidine-1-carboxylate |
| 1-Pyrrolidinecarboxylic acid, 3-(1-piperazinyl)-, 1,1-dimethylethyl ester |
| (S)-tert-Butyl 3-(piperazin-1-yl)pyrrolidine-1-carboxylate |