4-Nitro-3-(trifluoromethyl)benzaldehyde structure
|
Common Name | 4-Nitro-3-(trifluoromethyl)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 101066-57-3 | Molecular Weight | 219.117 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 291.9±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H4F3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130.3±27.3 °C | |
| Name | 4-Nitro-3-(trifluoromethyl)benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 291.9±40.0 °C at 760 mmHg |
| Molecular Formula | C8H4F3NO3 |
| Molecular Weight | 219.117 |
| Flash Point | 130.3±27.3 °C |
| Exact Mass | 219.014328 |
| PSA | 62.89000 |
| LogP | 2.45 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.520 |
| InChIKey | QLLHNXOKFCMSQR-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| HS Code | 2913000090 |
|---|
|
~%
4-Nitro-3-(trif... CAS#:101066-57-3 |
| Literature: Acher, Francine; Selvam, Chelliah; Triballeau, Nicolas; Pin, Jean-Philippe; Bertrand, Hugues-Oliver Patent: US2009/170813 A1, 2009 ; Location in patent: Page/Page column 28-29 ; US 20090170813 A1 |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| 3-trifluoromethyl-4-nitrobenzaldehyde |
| Benzaldehyde, 4-nitro-3-(trifluoromethyl)- |
| 4-Nitro-3-(trifluoromethyl)benzaldehyde |
| 4-nitro-3-trifluoromethylbenzaldehyde |