4-Nitro-3-(trifluoromethyl)-1H-pyrazole-5-carboxylic acid structure
|
Common Name | 4-Nitro-3-(trifluoromethyl)-1H-pyrazole-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1322805-15-1 | Molecular Weight | 225.082 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 450.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C5H2F3N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.4±28.7 °C | |
| Name | 4-nitro-5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 450.7±45.0 °C at 760 mmHg |
| Molecular Formula | C5H2F3N3O4 |
| Molecular Weight | 225.082 |
| Flash Point | 226.4±28.7 °C |
| Exact Mass | 224.999741 |
| PSA | 111.80000 |
| LogP | 1.51 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.539 |
| InChIKey | PSUXBAOGDOGJBK-UHFFFAOYSA-N |
| SMILES | O=C(O)c1n[nH]c(C(F)(F)F)c1[N+](=O)[O-] |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933199090 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Nitro-3-(trifluoromethyl)-1H-pyrazole-5-carboxylic acid |
| 4-nitro-5-(trifluoromethyl)-1H-pyrazoIe-3-carboxyIic acid |
| 1H-Pyrazole-5-carboxylic acid, 4-nitro-3-(trifluoromethyl)- |