tert-Butyl 3-(2-(tert-butoxy)-2-oxoethyl)-4-oxopiperidine-1-carboxylate structure
|
Common Name | tert-Butyl 3-(2-(tert-butoxy)-2-oxoethyl)-4-oxopiperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1010814-94-4 | Molecular Weight | 313.389 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 396.6±27.0 °C at 760 mmHg | |
| Molecular Formula | C16H27NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.6±23.7 °C | |
| Name | tert-Butyl 3-(2-(tert-butoxy)-2-oxoethyl)-4-oxopiperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 396.6±27.0 °C at 760 mmHg |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.389 |
| Flash Point | 193.6±23.7 °C |
| Exact Mass | 313.188934 |
| PSA | 72.91000 |
| LogP | 1.77 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.475 |
| InChIKey | ALIVCUSTZCGWKQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC1CN(C(=O)OC(C)(C)C)CCC1=O |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~50%
tert-Butyl 3-(2... CAS#:1010814-94-4 |
| Literature: ACTELION PHARMACEUTICALS LTD Patent: WO2008/26172 A1, 2008 ; Location in patent: Page/Page column 63 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl 3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4-oxopiperidine-1-carboxylate |
| 2-Methyl-2-propanyl 3-{2-[(2-methyl-2-propanyl)oxy]-2-oxoethyl}-4-oxo-1-piperidinecarboxylate |
| 3-Piperidineacetic acid, 1-[(1,1-dimethylethoxy)carbonyl]-4-oxo-, 1,1-dimethylethyl ester |