Astraisoflavan-7-O-β-D-glucoside structure
|
Common Name | Astraisoflavan-7-O-β-D-glucoside | ||
|---|---|---|---|---|
| CAS Number | 1011711-05-9 | Molecular Weight | 480.46 | |
| Density | N/A | Boiling Point | 674.4±55.0 °C(Predicted) | |
| Molecular Formula | C23H28O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Astraisoflavan-7-O-β-D-glucosideAstraganoside, an isoflavane compound, isolated from the roots of Astragalus membranaceus (known as ‘‘Huangqi’’)[1]. |
| Name | Astraganoside |
|---|
| Description | Astraganoside, an isoflavane compound, isolated from the roots of Astragalus membranaceus (known as ‘‘Huangqi’’)[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 674.4±55.0 °C(Predicted) |
|---|---|
| Molecular Formula | C23H28O11 |
| Molecular Weight | 480.46 |
| InChIKey | JTRBZHFVAAWBNR-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2COc3cc(OC4OC(CO)C(O)C(O)C4O)ccc3C2O)c(O)c1OC |
| Hazard Codes | Xi |
|---|