3-(dimethylamino)-1-(1H-indol-3-yl)propan-1-ol structure
|
Common Name | 3-(dimethylamino)-1-(1H-indol-3-yl)propan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 101264-47-5 | Molecular Weight | 218.29500 | |
| Density | 1.15g/cm3 | Boiling Point | 404.8ºC at 760 mmHg | |
| Molecular Formula | C13H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.6ºC | |
| Name | 3-(dimethylamino)-1-(1H-indol-3-yl)propan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 404.8ºC at 760 mmHg |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.29500 |
| Flash Point | 198.6ºC |
| Exact Mass | 218.14200 |
| PSA | 39.26000 |
| LogP | 2.15300 |
| Vapour Pressure | 2.8E-07mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | HFOWQNTXLGHABX-UHFFFAOYSA-N |
| SMILES | CN(C)CCC(O)c1c[nH]c2ccccc12 |
|
~%
3-(dimethylamin... CAS#:101264-47-5 |
| Literature: Upjohn Co. Patent: US2821532 , 1955 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 3-dimethylamino-1-indol-3-yl-propan-1-ol |