1-Propanone,3-(dimethylamino)-1-(1H-indol-3-yl) structure
|
Common Name | 1-Propanone,3-(dimethylamino)-1-(1H-indol-3-yl) | ||
|---|---|---|---|---|
| CAS Number | 24955-83-7 | Molecular Weight | 216.27900 | |
| Density | 1.137g/cm3 | Boiling Point | 389.3ºC at 760mmHg | |
| Molecular Formula | C13H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.2ºC | |
| Name | 3-(dimethylamino)-1-(1H-indol-3-yl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.137g/cm3 |
|---|---|
| Boiling Point | 389.3ºC at 760mmHg |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.27900 |
| Flash Point | 189.2ºC |
| Exact Mass | 216.12600 |
| PSA | 36.10000 |
| LogP | 2.30230 |
| Vapour Pressure | 2.88E-06mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | LAHVNBMMXFLOQD-UHFFFAOYSA-N |
| SMILES | CN(C)CCC(=O)c1c[nH]c2ccccc12 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2933990090 |
|---|
|
~%
1-Propanone,3-(... CAS#:24955-83-7 |
| Literature: Pini, Dario Gazzetta Chimica Italiana, 1980 , vol. 110, # 7/8 p. 473 - 478 |
|
~%
1-Propanone,3-(... CAS#:24955-83-7 |
| Literature: Pini, Dario Gazzetta Chimica Italiana, 1980 , vol. 110, # 7/8 p. 473 - 478 |
|
~%
1-Propanone,3-(... CAS#:24955-83-7 |
| Literature: Upjohn Co. Patent: US2821532 , 1955 ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| Indole,3-(3-dimethylaminopropionyl) |
| 1-Propanone,3-(dimethylamino)-1-indol-3-yl-(6CI,7CI,8CI) |
| 5-Dimethylamino-3-piperidinoacetylindole |
| 3-Dimethylamino-1-indol-3-yl-propan-1-on |
| 1-Propanone,3-(dimethylamino)-1-(1H-indol-3-yl) |
| 3-(3-Dimethylaminopropionyl)indole |
| 3-dimethylamino-1-indol-3-yl-propan-1-one |
| 3-(Dimethylamino)-1-(1H-indol-3-yl)-1-propanone |
| 3-Dimethylamino-1-oxo-1-indolyl-(3)-propan |