2-Chloro-1,3-dimethylimidazolidinium hexafluorophosphate structure
|
Common Name | 2-Chloro-1,3-dimethylimidazolidinium hexafluorophosphate | ||
|---|---|---|---|---|
| CAS Number | 101385-69-7 | Molecular Weight | 278.56300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H10ClF6N2P | Melting Point | 231-233 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Chloro-1,3-dimethylimidazolidinium hexafluorophosphate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 231-233 °C(lit.) |
|---|---|
| Molecular Formula | C5H10ClF6N2P |
| Molecular Weight | 278.56300 |
| Exact Mass | 278.01700 |
| PSA | 19.84000 |
| LogP | 3.44800 |
| InChIKey | CNAKHAGVVMOXFE-UHFFFAOYSA-N |
| SMILES | CN1CC[N+](C)=C1Cl.F[P-](F)(F)(F)(F)F |
| Storage condition | 2-8°C |
| Water Solubility | acetonitrile: 0.1 g/mL, clear |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~95%
2-Chloro-1,3-di... CAS#:101385-69-7 |
| Literature: Kitamura, Mitsuru; Kato, So; Yano, Masakazu; Tashiro, Norifumi; Shiratake, Yuichiro; Sando, Mitsuyoshi; Okauchi, Tatsuo Organic and Biomolecular Chemistry, 2014 , vol. 12, # 25 p. 4397 - 4406 |
|
~%
2-Chloro-1,3-di... CAS#:101385-69-7 |
| Literature: Organic Letters, , vol. 2, # 23 p. 3539 - 3542 |
|
~%
2-Chloro-1,3-di... CAS#:101385-69-7 |
| Literature: Organic Preparations and Procedures International, , vol. 30, # 4 p. 477 - 481 |
| 2-Chloro-1,3-dimethyl-4,5-dihydro-1H-imidazol-3-ium hexafluorophosphate |
| 2-CHLORO-1,3-DIMETHYLIMIDAZOLINIUM HEXAFLUOROPHOSPHATE |
| 2-Chloro-1,3-dimethy |
| 2-Chloro-1,3-dimethyl-4,5-dihydro-1H-imidazol-3-ium hexafluorophosphate(V) |
| CIP 2-Chloro-1,3-diMethyliMidazolidiniuM hexafluorophosphate |
| MFCD00191914 |
| 2-Chloro-1,3-Dimethylimidazolidinium Hexafluorophosphate |
| 2-Chloro-1,3-dimethylimidazolidiniumhexafluorophosphate |
| 2-Chlor-1,3-dimethyl-imidazolidinium-hexafluorophosphat |
| CIP |
| 2-CHLORO-1,3-DIMETHYLIMIDAZOLINIUM PF6 |
| 2-Chloro-1,3-dimethyl-2-imidazolinium hexafluorophosphate |