1-(1-chloroethenyl)-4-nitrobenzene structure
|
Common Name | 1-(1-chloroethenyl)-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 10140-97-3 | Molecular Weight | 183.59200 | |
| Density | 1.293g/cm3 | Boiling Point | 265.9ºC at 760mmHg | |
| Molecular Formula | C8H6ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 114.6ºC | |
| Name | 1-(1-chloroethenyl)-4-nitrobenzene |
|---|
| Density | 1.293g/cm3 |
|---|---|
| Boiling Point | 265.9ºC at 760mmHg |
| Molecular Formula | C8H6ClNO2 |
| Molecular Weight | 183.59200 |
| Flash Point | 114.6ºC |
| Exact Mass | 183.00900 |
| PSA | 45.82000 |
| LogP | 3.32750 |
| Vapour Pressure | 0.0146mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | XTDAYGDHDWTKHX-UHFFFAOYSA-N |
| SMILES | C=C(Cl)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2904909090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |