2-Propynoic acid,3-(4-nitrophenyl)- structure
|
Common Name | 2-Propynoic acid,3-(4-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 2216-24-2 | Molecular Weight | 191.14000 | |
| Density | 1.47g/cm3 | Boiling Point | 402.8ºC at 760mmHg | |
| Molecular Formula | C9H5NO4 | Melting Point | 178-185ºC | |
| MSDS | N/A | Flash Point | 182.1ºC | |
| Name | 3-(4-nitrophenyl)prop-2-ynoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 402.8ºC at 760mmHg |
| Melting Point | 178-185ºC |
| Molecular Formula | C9H5NO4 |
| Molecular Weight | 191.14000 |
| Flash Point | 182.1ºC |
| Exact Mass | 191.02200 |
| PSA | 83.12000 |
| LogP | 1.55410 |
| Vapour Pressure | 3.28E-07mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | SMMZCQTZVBTDLS-UHFFFAOYSA-N |
| SMILES | O=C(O)C#Cc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2916399090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 7 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-nitrophenyl propynoic acid |