3-Bromo-4-nitrobenzoic acid structure
|
Common Name | 3-Bromo-4-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 101420-81-9 | Molecular Weight | 246.015 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 364.4±32.0 °C at 760 mmHg | |
| Molecular Formula | C7H4BrNO4 | Melting Point | 200-204ºC | |
| MSDS | Chinese USA | Flash Point | 174.2±25.1 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-bromo-4-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 364.4±32.0 °C at 760 mmHg |
| Melting Point | 200-204ºC |
| Molecular Formula | C7H4BrNO4 |
| Molecular Weight | 246.015 |
| Flash Point | 174.2±25.1 °C |
| Exact Mass | 244.932358 |
| PSA | 83.12000 |
| LogP | 2.51 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.650 |
| InChIKey | KKPPNEJUUOQRLE-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])c(Br)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2916399090 |
|
~%
3-Bromo-4-nitro... CAS#:101420-81-9 |
| Literature: Journal of the American Chemical Society, , vol. 72, p. 28,30 |
|
~%
3-Bromo-4-nitro... CAS#:101420-81-9 |
| Literature: Journal fuer Praktische Chemie (Leipzig), , vol. <2> 43, p. 204 |
|
~%
3-Bromo-4-nitro... CAS#:101420-81-9 |
| Literature: Journal fuer Praktische Chemie (Leipzig), , vol. <2> 43, p. 204 |
|
~%
3-Bromo-4-nitro... CAS#:101420-81-9 |
| Literature: Journal fuer Praktische Chemie (Leipzig), , vol. <2> 43, p. 204 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Bartoli indole synthesis on solid supports.
Org. Lett. 5 , 2829, (2003) [reaction: see text] Bartoli indole synthesis has been performed for the first time on solid supports. Starting from Merrifield resin, immobilization of five nitro benzoic acids was performed. Additio... |
| Benzoic acid,3-bromo-4-nitro |
| MFCD04117949 |
| 4-Nitro-3-bromobenzoic acid |
| 3-Bromo-4-nitrobenzoicacid |
| Benzoic acid, 3-bromo-4-nitro- |
| 3-Bromo-4-nitrobenzoic acid |
| 3-Brom-4-nitro-benzoesaeure |