N'-[[4-(dimethylamino)phenyl]methyl]-3-methyl-1,2-oxazole-5-carbohydrazide structure
|
Common Name | N'-[[4-(dimethylamino)phenyl]methyl]-3-methyl-1,2-oxazole-5-carbohydrazide | ||
|---|---|---|---|---|
| CAS Number | 101670-70-6 | Molecular Weight | 274.31800 | |
| Density | 1.194g/cm3 | Boiling Point | 446.4ºC at 760mmHg | |
| Molecular Formula | C14H18N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.7ºC | |
| Name | N'-[[4-(dimethylamino)phenyl]methyl]-3-methyl-1,2-oxazole-5-carbohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.194g/cm3 |
|---|---|
| Boiling Point | 446.4ºC at 760mmHg |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.31800 |
| Flash Point | 223.7ºC |
| Exact Mass | 274.14300 |
| PSA | 70.40000 |
| LogP | 2.26540 |
| Vapour Pressure | 3.67E-08mmHg at 25°C |
| Index of Refraction | 1.59 |
| InChIKey | QRGMGGLQHINTDK-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)NNCc2ccc(N(C)C)cc2)on1 |
|
~%
N'-[[4-(dimethy... CAS#:101670-70-6 |
| Literature: Journal of Medicinal and Pharmaceutical Chemistry, , vol. 3, p. 241 - 252 |
|
~%
N'-[[4-(dimethy... CAS#:101670-70-6 |
| Literature: Journal of Medicinal and Pharmaceutical Chemistry, , vol. 3, p. 241 - 252 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N'-[(4-dimethylaminophenyl)methyl]-3-methyl-1,2-oxazole-5-carbohydrazide |
| N-<4-Dimethylamino-benzyl>-N'-<3-methyl-isoxazolyl-(5)-carbonyl>-hydrazin |
| 3-methyl-isoxazole-5-carboxylic acid N'-(4-dimethylamino-benzyl)-hydrazide |
| 3-Methyl-5-isoxazolecarboxylic acid 2-(p-(dimethylamino)benzyl)hydrazide |
| 5-ISOXAZOLECARBOXYLIC ACID,3-METHYL-,2-(p-(DIMETHYLAMINO)BENZYL)HYDRAZIDE |