phenyl pyrrolidine-1-sulfonate structure
|
Common Name | phenyl pyrrolidine-1-sulfonate | ||
|---|---|---|---|---|
| CAS Number | 1017-50-1 | Molecular Weight | 227.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | phenyl pyrrolidine-1-sulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H13NO3S |
|---|---|
| Molecular Weight | 227.28000 |
| Exact Mass | 227.06200 |
| PSA | 54.99000 |
| LogP | 2.42470 |
| InChIKey | LXGCVSBBIPBFBG-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Oc1ccccc1)N1CCCC1 |
| HS Code | 2933990090 |
|---|
|
~89%
phenyl pyrrolid... CAS#:1017-50-1 |
| Literature: Phosphorus and Sulfur and the Related Elements, , vol. 20, p. 371 - 376 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Pyrrolidinesulfonic acid,phenyl ester |
| Pyrrolidinosulfonsaeure-phenylester |
| pyrrolidine-1-sulfonic acid phenyl ester |
| N-(phenoxysulfonyl)-pyrrolidine |