2-Quinolinecarboxylicacid, 6-chloro-4-hydroxy- structure
|
Common Name | 2-Quinolinecarboxylicacid, 6-chloro-4-hydroxy- | ||
|---|---|---|---|---|
| CAS Number | 10174-72-8 | Molecular Weight | 223.61300 | |
| Density | 1.549g/cm3 | Boiling Point | 399.1ºC at 760mmHg | |
| Molecular Formula | C10H6ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.2ºC | |
| Name | 6-chloro-4-oxo-1H-quinoline-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.549g/cm3 |
|---|---|
| Boiling Point | 399.1ºC at 760mmHg |
| Molecular Formula | C10H6ClNO3 |
| Molecular Weight | 223.61300 |
| Flash Point | 195.2ºC |
| Exact Mass | 223.00400 |
| PSA | 70.42000 |
| LogP | 2.29200 |
| Vapour Pressure | 4.36E-07mmHg at 25°C |
| Index of Refraction | 1.648 |
| InChIKey | FBHYBXRWVNVMRY-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(=O)c2cc(Cl)ccc2[nH]1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Chloro-4-hydroxyquinoline-2-carboxylic acid |
| 6-chlorokynurenic acid |
| 6-Chlor-4-hydroxy-chinolin-2-carbonsaeure |
| 4-Hydroxy-6-chlor-chinaldinsaeure |
| 6-chloroisothiazolo[5,4-b]pyridine-3-carboxylic acid |
| 6-chloro-4-hydroxy-2-carboxyquinoline |