2-Quinolinecarboxylicacid, 7-chloro-4-hydroxy-, methyl ester structure
|
Common Name | 2-Quinolinecarboxylicacid, 7-chloro-4-hydroxy-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 5347-19-3 | Molecular Weight | 237.63900 | |
| Density | 1.4g/cm3 | Boiling Point | 367.2ºC at 760mmHg | |
| Molecular Formula | C11H8ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.9ºC | |
| Name | methyl 7-chloro-4-oxo-1H-quinoline-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 367.2ºC at 760mmHg |
| Molecular Formula | C11H8ClNO3 |
| Molecular Weight | 237.63900 |
| Flash Point | 175.9ºC |
| Exact Mass | 237.01900 |
| PSA | 59.42000 |
| LogP | 2.38040 |
| Index of Refraction | 1.591 |
| InChIKey | QHPKUXTUEVUQAZ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(=O)c2ccc(Cl)cc2[nH]1 |
| HS Code | 2933499090 |
|---|
|
~%
2-Quinolinecarb... CAS#:5347-19-3 |
| Literature: WO2004/2960 A1, ; Page 128-131 ; WO 2004/002960 A1 |
|
~%
2-Quinolinecarb... CAS#:5347-19-3 |
| Literature: Journal of the American Chemical Society, , vol. 68, p. 1232,1236 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-chloro-4-hydroxy-2-quinolinecarboxylic acid methyl ester |
| 7-chloro-4-hydroxy-quinoline-2-carboxylic acid methyl ester |
| 7-chloro-4-hydroxy-2-methoxycarbonylquinoline |
| 7-Chlor-4-hydroxy-chinolin-2-carbonsaeure-methylester |
| Methyl 7-chloro-4-hydroxyquinoline-2-carboxylate |
| methyl 7-chloro-4-hydroxy-2-quinolinecarboxylate |