1-(4-methoxyphenyl)decan-1-one structure
|
Common Name | 1-(4-methoxyphenyl)decan-1-one | ||
|---|---|---|---|---|
| CAS Number | 101741-01-9 | Molecular Weight | 262.38700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-methoxyphenyl)decan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H26O2 |
|---|---|
| Molecular Weight | 262.38700 |
| Exact Mass | 262.19300 |
| PSA | 26.30000 |
| LogP | 5.01860 |
| InChIKey | LAVLQQKHORTNFF-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)c1ccc(OC)cc1 |
|
~93%
1-(4-methoxyphe... CAS#:101741-01-9 |
| Literature: Sarvari, Mona Hosseini; Sharghi, Hashem Helvetica Chimica Acta, 2005 , vol. 88, # 8 p. 2282 - 2287 |
|
~%
1-(4-methoxyphe... CAS#:101741-01-9 |
| Literature: Matsuda et al. Technology Reports of the Osaka University, 1956 , vol. 6, p. 393 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| 1-Decanone,1-(4-methoxyphenyl) |
| 1-(4-methoxy-phenyl)-decan-1-one |