2,3-Dichloro-6-(trifluoromethyl)aniline structure
|
Common Name | 2,3-Dichloro-6-(trifluoromethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 1017777-92-2 | Molecular Weight | 230.01500 | |
| Density | N/A | Boiling Point | 235.9ºC at 760 mmHg | |
| Molecular Formula | C7H4Cl2F3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 96.5ºC | |
| Name | 2,3-Dichloro-6-(trifluoromethyl)aniline |
|---|
| Boiling Point | 235.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C7H4Cl2F3N |
| Molecular Weight | 230.01500 |
| Flash Point | 96.5ºC |
| Exact Mass | 228.96700 |
| PSA | 26.02000 |
| LogP | 4.17560 |
| Vapour Pressure | 0.0487mmHg at 25°C |
| Index of Refraction | 1.518 |
| InChIKey | NESDKBLXQJESKV-UHFFFAOYSA-N |
| SMILES | Nc1c(C(F)(F)F)ccc(Cl)c1Cl |
| HS Code | 2921420090 |
|---|
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |