2,3-dichloro-6-(trifluoromethyl)benzaldehyde structure
|
Common Name | 2,3-dichloro-6-(trifluoromethyl)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 186517-27-1 | Molecular Weight | 243.01000 | |
| Density | 1.533g/cm3 | Boiling Point | 244.7ºC at 760 mmHg | |
| Molecular Formula | C8H3Cl2F3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 101.8ºC | |
| Name | 2,3-dichloro-6-(trifluoromethyl)benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.533g/cm3 |
|---|---|
| Boiling Point | 244.7ºC at 760 mmHg |
| Molecular Formula | C8H3Cl2F3O |
| Molecular Weight | 243.01000 |
| Flash Point | 101.8ºC |
| Exact Mass | 241.95100 |
| PSA | 17.07000 |
| LogP | 3.82470 |
| Vapour Pressure | 0.03mmHg at 25°C |
| Index of Refraction | 1.514 |
| InChIKey | QCYGNWQELPOXBL-UHFFFAOYSA-N |
| SMILES | O=Cc1c(C(F)(F)F)ccc(Cl)c1Cl |
| HS Code | 2913000090 |
|---|
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| jrd-1875 |