2,4-Dichloro-3-ethyl-6-aminophenol hydrochloride structure
|
Common Name | 2,4-Dichloro-3-ethyl-6-aminophenol hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 101819-99-2 | Molecular Weight | 242.53000 | |
| Density | N/A | Boiling Point | 338.2ºC at 760 mmHg | |
| Molecular Formula | C8H10Cl3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.3ºC | |
| Name | 6-Amino-2,4-dichloro-3-ethylphenol hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 338.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C8H10Cl3NO |
| Molecular Weight | 242.53000 |
| Flash Point | 158.3ºC |
| Exact Mass | 240.98300 |
| PSA | 46.25000 |
| LogP | 4.22680 |
| Vapour Pressure | 5.08E-05mmHg at 25°C |
| InChIKey | XZZITYVICUAZNB-UHFFFAOYSA-N |
| SMILES | CCc1c(Cl)cc(N)c(O)c1Cl.Cl |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2922299090 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 6-amino-2,4-dichloro-3-ethylphenol,hydrochloride |
| 6-Amino-2,4-dichloro-3-ethylphenol Hydrochloride |
| 2,4-Dichloro-3-ethyl-6-aminophenol hydrochloride |