N-(4-Biphenylyl)anthranilic acid structure
|
Common Name | N-(4-Biphenylyl)anthranilic acid | ||
|---|---|---|---|---|
| CAS Number | 101895-15-2 | Molecular Weight | 289.32800 | |
| Density | 1.24g/cm3 | Boiling Point | 484.3ºC at 760mmHg | |
| Molecular Formula | C19H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.7ºC | |
| Name | 2-(4-phenylanilino)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 484.3ºC at 760mmHg |
| Molecular Formula | C19H15NO2 |
| Molecular Weight | 289.32800 |
| Flash Point | 246.7ºC |
| Exact Mass | 289.11000 |
| PSA | 49.33000 |
| LogP | 4.86840 |
| Vapour Pressure | 3.42E-10mmHg at 25°C |
| Index of Refraction | 1.67 |
| InChIKey | VSICPUMVMJXLOE-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1Nc1ccc(-c2ccccc2)cc1 |
|
~%
N-(4-Biphenylyl... CAS#:101895-15-2 |
| Literature: Albert; Gledhill Journal of the Society of Chemical Industry, London, 1945 , vol. 64, p. 169,170 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Benzoic acid,2-([1,1'-biphenyl]-4-ylamino) |
| ANTHRANILIC ACID,N-(4-BIPHENYLYL) |
| N-(4-Biphenylyl)anthranilic acid |
| 2-[(4-biphenyl)amino]benzoic acid |
| 4'-Phenyldiphenylamine-2-carboxylic acid |
| N-biphenyl-4-yl-anthranilic acid |
| N-Biphenyl-4-yl-anthranilsaeure |