2-(5-hydroxy-1H-indol-3-yl)-N,N-dimethylethanamine oxide
Modify Date: 2025-09-28 13:38:53
2-(5-hydroxy-1H-indol-3-yl)-N,N-dimethylethanamine oxide structure
|
Common Name | 2-(5-hydroxy-1H-indol-3-yl)-N,N-dimethylethanamine oxide | ||
|---|---|---|---|---|
| CAS Number | 1019-44-9 | Molecular Weight | 220.26800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(5-hydroxy-1H-indol-3-yl)-N,N-dimethylethanamine oxide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H16N2O2 |
|---|---|
| Molecular Weight | 220.26800 |
| Exact Mass | 220.12100 |
| PSA | 65.45000 |
| LogP | 2.01110 |
| InChIKey | UADOMBGQYQPICP-UHFFFAOYSA-N |
| SMILES | C[N+](C)([O-])CCc1c[nH]c2ccc(O)cc12 |
|
~71%
2-(5-hydroxy-1H... CAS#:1019-44-9 |
| Literature: Qu, Shi-Jin; Wang, Gui-Feng; Duan, Wen-Hu; Yao, Shan-Yan; Zuo, Jian-Ping; Tan, Chang-Heng; Zhu, Da-Yuan Bioorganic and Medicinal Chemistry, 2011 , vol. 19, # 10 p. 3120 - 3127 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
|
Name: Selectivity index, ratio of CC50 for human HepG2.2.15 cells to IC50 for Hepatitis B v...
Source: ChEMBL
Target: N/A
External Id: CHEMBL1781476
|
|
Name: Cytotoxicity against human HepG2(2.2.15) cells after 8 days by MTT assay
Source: ChEMBL
Target: N/A
External Id: CHEMBL1781475
|
|
Name: Antiviral activity against Hepatitis B virus infected in human HepG2(2.2.15) cells as...
Source: ChEMBL
Target: Hepatitis B virus
External Id: CHEMBL1781474
|
Total 3, Current Page 1 of 1
1
| Bufotenin-N-oxid |
| bufotenine N12-oxide |
| Bufotenin oxide |
| bufotenine oxide |
| 1H-Indol-5-ol,3-(2-(dimethylamino)ethyl)-,N-oxide |
| 3-[2-(dimethyl-oxy-amino)-ethyl]-indol-5-ol |
| 3-[2-(Dimethyl-oxy-amino)-aethyl]-indol-5-ol |