3-methyl-2-(2,4,6-trimethoxyphenyl)-1,3-oxazolidine structure
|
Common Name | 3-methyl-2-(2,4,6-trimethoxyphenyl)-1,3-oxazolidine | ||
|---|---|---|---|---|
| CAS Number | 101932-26-7 | Molecular Weight | 253.29400 | |
| Density | 1.115g/cm3 | Boiling Point | 349.9ºC at 760 mmHg | |
| Molecular Formula | C13H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 103.7ºC | |
| Name | 3-methyl-2-(2,4,6-trimethoxyphenyl)-1,3-oxazolidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.115g/cm3 |
|---|---|
| Boiling Point | 349.9ºC at 760 mmHg |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.29400 |
| Flash Point | 103.7ºC |
| Exact Mass | 253.13100 |
| PSA | 40.16000 |
| LogP | 1.61090 |
| Vapour Pressure | 4.56E-05mmHg at 25°C |
| Index of Refraction | 1.512 |
| InChIKey | BHLAYNZWHMXGAZ-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c(C2OCCN2C)c(OC)c1 |
|
~%
3-methyl-2-(2,4... CAS#:101932-26-7 |
| Literature: Robbe; Fernandez; Dubief; et al. European Journal of Medicinal Chemistry, 1982 , vol. 17, # 3 p. 235 - 243 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Methyl-2-(2,4,6-trimethoxyphenyl)oxazolidine |
| Oxazolidine,3-methyl-2-(2,4,6-trimethoxyphenyl) |