4-(2,5-dimethyl-phenyl)-thiazol-2-ylamine structure
|
Common Name | 4-(2,5-dimethyl-phenyl)-thiazol-2-ylamine | ||
|---|---|---|---|---|
| CAS Number | 101967-39-9 | Molecular Weight | 204.29100 | |
| Density | 1.185g/cm3 | Boiling Point | 351.8ºC at 760mmHg | |
| Molecular Formula | C11H12N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.5ºC | |
| Name | 4-(2,5-dimethylphenyl)-1,3-thiazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.185g/cm3 |
|---|---|
| Boiling Point | 351.8ºC at 760mmHg |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.29100 |
| Flash Point | 166.5ºC |
| Exact Mass | 204.07200 |
| PSA | 67.15000 |
| LogP | 3.59030 |
| Vapour Pressure | 4.01E-05mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | XMAIQILQRXZWMI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C)c(-c2csc(N)n2)c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2934100090 |
|
~%
4-(2,5-dimethyl... CAS#:101967-39-9 |
| Literature: Journal of the Indian Chemical Society, , vol. 33, p. 527,530 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| f0007-0961 |
| MFCD00985673 |