m-[(p-Aminophenyl)azo]benzenesulphonic acid
![m-[(p-Aminophenyl)azo]benzenesulphonic acid Structure](https://image.chemsrc.com/caspic/230/102-23-8.png)
m-[(p-Aminophenyl)azo]benzenesulphonic acid structure
|
Common Name | m-[(p-Aminophenyl)azo]benzenesulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 102-23-8 | Molecular Weight | 277.29900 | |
| Density | 1.43 | Boiling Point | N/A | |
| Molecular Formula | C12H11N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[(4-aminophenyl)diazenyl]benzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.43 |
|---|---|
| Molecular Formula | C12H11N3O3S |
| Molecular Weight | 277.29900 |
| Exact Mass | 277.05200 |
| PSA | 113.49000 |
| LogP | 4.59290 |
| Index of Refraction | 1.663 |
| InChIKey | BATBWCBBYMPOPE-UHFFFAOYSA-N |
| SMILES | Nc1ccc(N=Nc2cccc(S(=O)(=O)O)c2)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2927000090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
m-[(p-Aminophen... CAS#:102-23-8 |
| Literature: DE131860 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4'-Amino-azobenzol-sulfonsaeure-(3) |
| m-((p-Aminophenyl)azo)benzenesulphonic acid |
| m-[(p-aminophenyl)azo]benzenesulfonic acid |
| 4-aminoazobenzene-3'-sulfonic acid |
| 3-(4-Amino-phenylazo)-benzolsulfonsaeure |
| 4-Amino-azobenzol-3'-sulfonsaeure |
| 3-(4-amino-phenylazo)-benzenesulfonic acid |
| EINECS 203-015-2 |
| (Benzol-sulfonsaeure-(1))-(3 azo 4)-anilin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 3-[(4-aminophenyl)diazenyl]benzenesulfonic acid? |
| A: Polar surface area (PSA) of 3-[(4-aminophenyl)diazenyl]benzenesulfonic acid is 113.49000. |
| Q: What are the upstream materials of 3-[(4-aminophenyl)diazenyl]benzenesulfonic acid? |
| A: Related upstream materials(CAS) of 3-[(4-aminophenyl)diazenyl]benzenesulfonic acid: 618-06-4. |
| Q: What is the English name of 3-[(4-aminophenyl)diazenyl]benzenesulfonic acid? |
| A: The English name of 3-[(4-aminophenyl)diazenyl]benzenesulfonic acid is 3-[(4-aminophenyl)diazenyl]benzenesulfonic acid. |
| Q: What is the SMILES notation of 3-[(4-aminophenyl)diazenyl]benzenesulfonic acid? |
| A: SMILES notation of 3-[(4-aminophenyl)diazenyl]benzenesulfonic acid is Nc1ccc(N=Nc2cccc(S(=O)(=O)O)c2)cc1. |
| Q: What is the molecular formula of 3-[(4-aminophenyl)diazenyl]benzenesulfonic acid? |
| A: Molecular formula of 3-[(4-aminophenyl)diazenyl]benzenesulfonic acid is C12H11N3O3S. |
| Q: What is the CAS number of 3-[(4-aminophenyl)diazenyl]benzenesulfonic acid? |
| A: CAS number of 3-[(4-aminophenyl)diazenyl]benzenesulfonic acid is 102-23-8. |
| Q: What is the molecular weight of 3-[(4-aminophenyl)diazenyl]benzenesulfonic acid? |
| A: Molecular weight of 3-[(4-aminophenyl)diazenyl]benzenesulfonic acid is 277.29900. |
| Q: What is the LogP of 3-[(4-aminophenyl)diazenyl]benzenesulfonic acid? |
| A: LogP of 3-[(4-aminophenyl)diazenyl]benzenesulfonic acid is 4.59290. |
| Q: What is the InChIKey of 3-[(4-aminophenyl)diazenyl]benzenesulfonic acid? |
| A: InChIKey of 3-[(4-aminophenyl)diazenyl]benzenesulfonic acid is BATBWCBBYMPOPE-UHFFFAOYSA-N. |
| Q: What English synonyms does 3-[(4-aminophenyl)diazenyl]benzenesulfonic acid have? |
| A: English synonyms of 3-[(4-aminophenyl)diazenyl]benzenesulfonic acid: 4'-Amino-azobenzol-sulfonsaeure-(3), m-((p-Aminophenyl)azo)benzenesulphonic acid, m-[(p-aminophenyl)azo]benzenesulfonic acid, 4-aminoazobenzene-3'-sulfonic acid, 3-(4-Amino-phenylazo)-benzolsulfonsaeure, 4-Amino-azobenzol-3'-sulfonsaeure, 3-(4-amino-phenylazo)-benzenesulfonic acid, EINECS 203-015-2, (Benzol-sulfonsaeure-(1))-(3 azo 4)-anilin. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |