m-sulfanilic acid diazonium salt
m-sulfanilic acid diazonium salt structure
|
Common Name | m-sulfanilic acid diazonium salt | ||
|---|---|---|---|---|
| CAS Number | 618-06-4 | Molecular Weight | 184.17300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H4N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | m-sulfanilic acid diazonium salt |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H4N2O3S |
|---|---|
| Molecular Weight | 184.17300 |
| Exact Mass | 183.99400 |
| PSA | 93.73000 |
| LogP | 2.15608 |
| InChIKey | MQAGWJGGLKPBSC-UHFFFAOYSA-N |
| SMILES | N#[N+]c1cccc(S(=O)(=O)[O-])c1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 10 | |
CAS#:118-32-1
CAS#:84-87-7
CAS#:93-01-6![m-[(p-Aminophenyl)azo]benzenesulphonic acid structure](https://image.chemsrc.com/caspic/230/102-23-8.png)
CAS#:102-23-8
CAS#:34256-01-4
CAS#:98-11-3
CAS#:138-30-7
CAS#:71236-06-1
CAS#:121-47-1
CAS#:20677-52-5This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Half-life period was determined at 20 degree Celsius at UV lambdamax nm of 260 (11500...
Source: ChEMBL
Target: N/A
External Id: CHEMBL630185
|
|
Name: Inhibition of [3H]GABA binding to Gamma-aminobutyric acid (GABA-A) receptor of rat br...
Source: ChEMBL
Target: Gamma-aminobutyric acid receptor subunit alpha-3
External Id: CHEMBL681144
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| diazotierte 3-Amino-benzolsulfonsaeure |
| 3-Diazo-benzol-sulfonsaeure-(1) |
| 3-sulfo-benzenediazonium-betaine |
| 3-Sulfo-benzoldiazonium-betain |
| m-Diazobenzolsulfonsaeure |
| 3-Diazonio-benzolsulfonat |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of m-sulfanilic acid diazonium salt? |
| A: LogP of m-sulfanilic acid diazonium salt is 2.15608. |
| Q: What is the SMILES notation of m-sulfanilic acid diazonium salt? |
| A: SMILES notation of m-sulfanilic acid diazonium salt is N#[N+]c1cccc(S(=O)(=O)[O-])c1. |
| Q: What English synonyms does m-sulfanilic acid diazonium salt have? |
| A: English synonyms of m-sulfanilic acid diazonium salt: diazotierte 3-Amino-benzolsulfonsaeure, 3-Diazo-benzol-sulfonsaeure-(1), 3-sulfo-benzenediazonium-betaine, 3-Sulfo-benzoldiazonium-betain, m-Diazobenzolsulfonsaeure, 3-Diazonio-benzolsulfonat. |
| Q: What is the Chinese name of 618-06-4? |
| A: Chinese name of 618-06-4 is 618-06-4. |
| Q: What is the polar surface area (PSA) of m-sulfanilic acid diazonium salt? |
| A: Polar surface area (PSA) of m-sulfanilic acid diazonium salt is 93.73000. |
| Q: What is the CAS number of m-sulfanilic acid diazonium salt? |
| A: CAS number of m-sulfanilic acid diazonium salt is 618-06-4. |
| Q: What is the molecular weight of m-sulfanilic acid diazonium salt? |
| A: Molecular weight of m-sulfanilic acid diazonium salt is 184.17300. |
| Q: What is the English name of m-sulfanilic acid diazonium salt? |
| A: The English name of m-sulfanilic acid diazonium salt is m-sulfanilic acid diazonium salt. |
| Q: What is the InChIKey of m-sulfanilic acid diazonium salt? |
| A: InChIKey of m-sulfanilic acid diazonium salt is MQAGWJGGLKPBSC-UHFFFAOYSA-N. |
| Q: What is the molecular formula of m-sulfanilic acid diazonium salt? |
| A: Molecular formula of m-sulfanilic acid diazonium salt is C6H4N2O3S. |