m-sulfanilic acid diazonium salt structure
|
Common Name | m-sulfanilic acid diazonium salt | ||
|---|---|---|---|---|
| CAS Number | 618-06-4 | Molecular Weight | 184.17300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H4N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | m-sulfanilic acid diazonium salt |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H4N2O3S |
|---|---|
| Molecular Weight | 184.17300 |
| Exact Mass | 183.99400 |
| PSA | 93.73000 |
| LogP | 2.15608 |
| InChIKey | MQAGWJGGLKPBSC-UHFFFAOYSA-N |
| SMILES | N#[N+]c1cccc(S(=O)(=O)[O-])c1 |
| Precursor 0 | |
|---|---|
| DownStream 10 | |
|
Name: Half-life period was determined at 20 degree Celsius at UV lambdamax nm of 260 (11500...
Source: ChEMBL
Target: N/A
External Id: CHEMBL630185
|
|
Name: Inhibition of [3H]GABA binding to Gamma-aminobutyric acid (GABA-A) receptor of rat br...
Source: ChEMBL
Target: Gamma-aminobutyric acid receptor subunit alpha-3
External Id: CHEMBL681144
|
| diazotierte 3-Amino-benzolsulfonsaeure |
| 3-Diazo-benzol-sulfonsaeure-(1) |
| 3-sulfo-benzenediazonium-betaine |
| 3-Sulfo-benzoldiazonium-betain |
| m-Diazobenzolsulfonsaeure |
| 3-Diazonio-benzolsulfonat |