(S)-(-)-1-(2-METHOXYBENZOYL)-2-(METHOXYMETHYL)PYRROLIDINE structure
|
Common Name | (S)-(-)-1-(2-METHOXYBENZOYL)-2-(METHOXYMETHYL)PYRROLIDINE | ||
|---|---|---|---|---|
| CAS Number | 102069-84-1 | Molecular Weight | 249.30600 | |
| Density | 1.109g/cm3 | Boiling Point | 391.1ºC at 760 mmHg | |
| Molecular Formula | C14H19NO3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | [(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-(2-methoxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.109g/cm3 |
|---|---|
| Boiling Point | 391.1ºC at 760 mmHg |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.30600 |
| Flash Point | >230 °F |
| Exact Mass | 249.13600 |
| PSA | 38.77000 |
| LogP | 1.88410 |
| Vapour Pressure | 2.53E-06mmHg at 25°C |
| Index of Refraction | n20/D 1.54(lit.) |
| InChIKey | CECTWDBFDAJIEO-NSHDSACASA-N |
| SMILES | COCC1CCCN1C(=O)c1ccccc1OC |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| 2-methoxymethylpyrrolidine 2-methoxybenzamide |
| MFCD00075415 |