4-Bromo-5-fluoro-2-nitrobenzoic acid structure
|
Common Name | 4-Bromo-5-fluoro-2-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1020717-99-0 | Molecular Weight | 264.005 | |
| Density | 2.0±0.1 g/cm3 | Boiling Point | 367.6±42.0 °C at 760 mmHg | |
| Molecular Formula | C7H3BrFNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.1±27.9 °C | |
| Name | 2-Nitro-4-Bromo-5-Fluorobenzoic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 367.6±42.0 °C at 760 mmHg |
| Molecular Formula | C7H3BrFNO4 |
| Molecular Weight | 264.005 |
| Flash Point | 176.1±27.9 °C |
| Exact Mass | 262.922943 |
| PSA | 83.12000 |
| LogP | 2.31 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | JZVCMOJSPCGLTC-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(F)c(Br)cc1[N+](=O)[O-] |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2916399090 |
|
~%
4-Bromo-5-fluor... CAS#:1020717-99-0 |
| Literature: WO2010/37210 A1, ; Page/Page column 79-80 ; WO 2010/037210 A1 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid, 4-bromo-5-fluoro-2-nitro- |
| WNR DF CE FVQ |
| 4-Bromo-5-fluoro-2-nitrobenzoic acid |