2-Bromo-3,4,5-Trifluoronitrobenzene structure
|
Common Name | 2-Bromo-3,4,5-Trifluoronitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 1020718-01-7 | Molecular Weight | 255.977 | |
| Density | 2.0±0.1 g/cm3 | Boiling Point | 220.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C6HBrF3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 87.3±25.9 °C | |
| Name | 2-Bromo-3,4,5-Trifluoronitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 220.8±35.0 °C at 760 mmHg |
| Molecular Formula | C6HBrF3NO2 |
| Molecular Weight | 255.977 |
| Flash Point | 87.3±25.9 °C |
| Exact Mass | 254.914261 |
| PSA | 45.82000 |
| LogP | 1.97 |
| Vapour Pressure | 0.2±0.4 mmHg at 25°C |
| Index of Refraction | 1.535 |
| InChIKey | RISQAVRTASTTPY-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(F)c(F)c(F)c1Br |
| Hazard Codes | T+ |
|---|---|
| RIDADR | 2810.0 |
| HS Code | 2904909090 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-bromo-1,2,3-trifluoro-5-nitrobenzene |
| Benzene, 2-bromo-3,4,5-trifluoro-1-nitro- |
| 2-Bromo-3,4,5-trifluoro-1-nitrobenzene |