Oxcarbazepine-D4 structure
|
Common Name | Oxcarbazepine-D4 | ||
|---|---|---|---|---|
| CAS Number | 1020719-71-4 | Molecular Weight | 252.26800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Oxcarbazepine-D4Oxcarbazepine-D4 (GP 47680-D4) is the deuterium labeled Oxcarbazepine. Oxcarbazepine is a sodium channel blocker[1]. Oxcarbazepine significantly inhibits glioblastoma cell growth and induces apoptosis or G2/M arrest in glioblastoma cell lines[2]. Anti-cancer and anticonvulsant effects[2][3]. |
| Name | 1,2,3,4-tetradeuterio-6-oxo-5H-benzo[b][1]benzazepine-11-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Description | Oxcarbazepine-D4 (GP 47680-D4) is the deuterium labeled Oxcarbazepine. Oxcarbazepine is a sodium channel blocker[1]. Oxcarbazepine significantly inhibits glioblastoma cell growth and induces apoptosis or G2/M arrest in glioblastoma cell lines[2]. Anti-cancer and anticonvulsant effects[2][3]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C15H12N2O2 |
|---|---|
| Molecular Weight | 252.26800 |
| Exact Mass | 252.09000 |
| PSA | 63.40000 |
| LogP | 3.40750 |
| InChIKey | CTRLABGOLIVAIY-DNZPNURCSA-N |
| SMILES | NC(=O)N1c2ccccc2CC(=O)c2ccccc21 |
| Oxacarbazepine-d4 |
| [2H4]-Oxcarbazepine |
| Oxetol-d4 |
| Oxecarb-d4 |
| Oxcarbazepine-D4 (Major) |
| Trileptal-d4 |
| Aurene-d4 |