diethyl 1-phenylethenyl phosphate structure
|
Common Name | diethyl 1-phenylethenyl phosphate | ||
|---|---|---|---|---|
| CAS Number | 1021-45-0 | Molecular Weight | 256.23500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 1-phenylethenyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H17O4P |
|---|---|
| Molecular Weight | 256.23500 |
| Exact Mass | 256.08600 |
| PSA | 54.57000 |
| LogP | 3.85500 |
| InChIKey | TYPMOBYJZAEEDU-UHFFFAOYSA-N |
| SMILES | C=C(OP(=O)(OCC)OCC)c1ccccc1 |
| HS Code | 2919900090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 8 | |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Phosphorsaeure-diethyl-(1-phenylvinyl)-ester |
| 1-[(diethoxyphosphinyl )oxo]styrene |
| 1-[(diethoxyphosphinyl)oxy]styrene |
| 1-phenylvinyl diethylphosphate |
| O,O-diethyl 1-phenylvinylphosphate |
| diethyl 1-phenylvinyl phosphate |
| Phosphoric acid,diethyl 1-phenylethenyl ester |
| phosphoric acid diethyl 1-phenyl-vinyl ester |
| 1-<(diethoxyphosphinyl)oxy>-1-phenylethylene |