dimethyl 1-phenylethenyl phosphate structure
|
Common Name | dimethyl 1-phenylethenyl phosphate | ||
|---|---|---|---|---|
| CAS Number | 4202-12-4 | Molecular Weight | 228.18200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl 1-phenylethenyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H13O4P |
|---|---|
| Molecular Weight | 228.18200 |
| Exact Mass | 228.05500 |
| PSA | 54.57000 |
| LogP | 3.07480 |
| InChIKey | OONVRGGBDRDTPQ-UHFFFAOYSA-N |
| SMILES | C=C(OP(=O)(OC)OC)c1ccccc1 |
| HS Code | 2919900090 |
|---|
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 1-phenylvinyl dimethyl phosphate |
| dimethyl 1-phenylvinyl phosphate |
| Phosphoric acid,dimethyl 1-phenylvinyl ester |
| Phosphoric acid,dimethyl 1-phenylethenyl ester |