3',5'-DI-O-ACETYL-2'-DEOXY-2'-FLUOROURIDINE structure
|
Common Name | 3',5'-DI-O-ACETYL-2'-DEOXY-2'-FLUOROURIDINE | ||
|---|---|---|---|---|
| CAS Number | 10212-13-2 | Molecular Weight | 330.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15FN2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3',5'-DI-O-ACETYL-2'-DEOXY-2'-FLUOROURIDINE3′,5′-Di-O-acetyl-2′-deoxy-2′-fluorouridine is a uridine analog. Uridine has potential antiepileptic effects, and its analogs can be used to study anticonvulsant and anxiolytic activities, as well as to develop new antihypertensive agents[1]. |
| Name | 1-[4-acetyl-3-fluoro-4-hydroxy-5-(1-hydroxy-2-oxopropyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Description | 3′,5′-Di-O-acetyl-2′-deoxy-2′-fluorouridine is a uridine analog. Uridine has potential antiepileptic effects, and its analogs can be used to study anticonvulsant and anxiolytic activities, as well as to develop new antihypertensive agents[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C13H15FN2O7 |
|---|---|
| Molecular Weight | 330.27 |
| Exact Mass | 330.08600 |
| PSA | 138.95000 |
| InChIKey | SGWNQYIJJOVQCM-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1OC(n2ccc(=O)[nH]c2=O)C(F)C1OC(C)=O |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 1-[4-acetyl-3-fluoro-4-hydroxy-5-(1-hydroxy-2-oxopropyl)-2-oxolanyl]pyrimidine-2,4-dione |
| 3',5'-O-diacetyl-2'-deoxy-2'-fluoro-uridine |
| O3',O5'-diacetyl-2'-fluoro-2'-deoxy-uridine |
| 2'-deoxy-3',5'-di-O-acetyl-2'-fluorouridine |
| 1-[4-ethanoyl-3-fluoranyl-4-oxidanyl-5-(1-oxidanyl-2-oxidanylidene-propyl)oxolan-2-yl]pyrimidine-2,4-dione |