4-[(3-propan-2-ylphenyl)carbamoyl]benzoic acid
![4-[(3-propan-2-ylphenyl)carbamoyl]benzoic acid Structure](https://image.chemsrc.com/caspic/428/102121-12-0.png)
4-[(3-propan-2-ylphenyl)carbamoyl]benzoic acid structure
|
Common Name | 4-[(3-propan-2-ylphenyl)carbamoyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 102121-12-0 | Molecular Weight | 283.32200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 4-[(3-Propylphenyl)carbamoyl]benzoic acid (CAS: 102121-12-0, molecular formula: C17H17NO3, molecular weight: 283.32200), for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[(3-propan-2-ylphenyl)carbamoyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H17NO3 |
|---|---|
| Molecular Weight | 283.32200 |
| Exact Mass | 283.12100 |
| PSA | 66.40000 |
| LogP | 3.83350 |
| InChIKey | GTUXJWHMZLCKMG-UHFFFAOYSA-N |
| SMILES | CC(C)c1cccc(NC(=O)c2ccc(C(=O)O)cc2)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~80%
4-[(3-propan-2-... CAS#:102121-12-0 |
| Literature: Kagechika, Hiroyuki; Kawachi, Emiko; Hashimoto, Yuichi; Himi, Toshiyuki; Shudo, Koichi Journal of Medicinal Chemistry, 1988 , vol. 31, # 11 p. 2182 - 2192 |
|
~%
4-[(3-propan-2-... CAS#:102121-12-0 |
| Literature: Kagechika, Hiroyuki; Kawachi, Emiko; Hashimoto, Yuichi; Himi, Toshiyuki; Shudo, Koichi Journal of Medicinal Chemistry, 1988 , vol. 31, # 11 p. 2182 - 2192 |
|
~%
4-[(3-propan-2-... CAS#:102121-12-0 |
| Literature: Kagechika, Hiroyuki; Kawachi, Emiko; Hashimoto, Yuichi; Himi, Toshiyuki; Shudo, Koichi Journal of Medicinal Chemistry, 1988 , vol. 31, # 11 p. 2182 - 2192 |
![methyl 4-[(3-isopropylphenyl)carbamoyl]benzoate structure](https://image.chemsrc.com/caspic/390/102121-13-1.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-[(3-isopropylphenyl)carbamoyl]benzoic acid |
| Benzoic acid,4-[[[3-(1-methylethyl)phenyl]amino]carbonyl] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-[(3-propan-2-ylphenyl)carbamoyl]benzoic acid? |
| A: Molecular formula of 4-[(3-propan-2-ylphenyl)carbamoyl]benzoic acid is C17H17NO3. |
| Q: What is the molecular weight of 4-[(3-propan-2-ylphenyl)carbamoyl]benzoic acid? |
| A: Molecular weight of 4-[(3-propan-2-ylphenyl)carbamoyl]benzoic acid is 283.32200. |
| Q: What is the English name of 4-[(3-propan-2-ylphenyl)carbamoyl]benzoic acid? |
| A: The English name of 4-[(3-propan-2-ylphenyl)carbamoyl]benzoic acid is 4-[(3-propan-2-ylphenyl)carbamoyl]benzoic acid. |
| Q: What is the InChIKey of 4-[(3-propan-2-ylphenyl)carbamoyl]benzoic acid? |
| A: InChIKey of 4-[(3-propan-2-ylphenyl)carbamoyl]benzoic acid is GTUXJWHMZLCKMG-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 4-[(3-propan-2-ylphenyl)carbamoyl]benzoic acid? |
| A: Polar surface area (PSA) of 4-[(3-propan-2-ylphenyl)carbamoyl]benzoic acid is 66.40000. |
| Q: What is the LogP of 4-[(3-propan-2-ylphenyl)carbamoyl]benzoic acid? |
| A: LogP of 4-[(3-propan-2-ylphenyl)carbamoyl]benzoic acid is 3.83350. |
| Q: What is the CAS number of 4-[(3-propan-2-ylphenyl)carbamoyl]benzoic acid? |
| A: CAS number of 4-[(3-propan-2-ylphenyl)carbamoyl]benzoic acid is 102121-12-0. |
| Q: What English synonyms does 4-[(3-propan-2-ylphenyl)carbamoyl]benzoic acid have? |
| A: English synonyms of 4-[(3-propan-2-ylphenyl)carbamoyl]benzoic acid: 4-[(3-isopropylphenyl)carbamoyl]benzoic acid, Benzoic acid,4-[[[3-(1-methylethyl)phenyl]amino]carbonyl]. |
| Q: What is the SMILES notation of 4-[(3-propan-2-ylphenyl)carbamoyl]benzoic acid? |
| A: SMILES notation of 4-[(3-propan-2-ylphenyl)carbamoyl]benzoic acid is CC(C)c1cccc(NC(=O)c2ccc(C(=O)O)cc2)c1. |
| Q: What are the upstream materials of 4-[(3-propan-2-ylphenyl)carbamoyl]benzoic acid? |
| A: Related upstream materials(CAS) of 4-[(3-propan-2-ylphenyl)carbamoyl]benzoic acid: 102121-13-1;5369-16-4;7377-26-6. |