6-Chlornaphthalen-2-sulfonylchlorid structure
|
Common Name | 6-Chlornaphthalen-2-sulfonylchlorid | ||
|---|---|---|---|---|
| CAS Number | 102153-63-9 | Molecular Weight | 261.124 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 402.9±20.0 °C at 760 mmHg | |
| Molecular Formula | C10H6Cl2O2S | Melting Point | 108 °C | |
| MSDS | N/A | Flash Point | 197.5±21.8 °C | |
| Name | 6-Chloro-2-naphthylsulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 402.9±20.0 °C at 760 mmHg |
| Melting Point | 108 °C |
| Molecular Formula | C10H6Cl2O2S |
| Molecular Weight | 261.124 |
| Flash Point | 197.5±21.8 °C |
| Exact Mass | 259.946564 |
| PSA | 42.52000 |
| LogP | 3.81 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.650 |
| InChIKey | IYFIYGSJZIICOZ-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1ccc2cc(Cl)ccc2c1 |
| Hazard Codes | C |
|---|---|
| HS Code | 2904909090 |
|
~%
6-Chlornaphthal... CAS#:102153-63-9 |
| Literature: US6660739 B1, ; Page column 17 ; |
|
~%
6-Chlornaphthal... CAS#:102153-63-9 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 14, # 11 p. 2935 - 2939 |
|
~%
6-Chlornaphthal... CAS#:102153-63-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 47, # 21 p. 5167 - 5182 Bioorganic and Medicinal Chemistry, , vol. 13, # 12 p. 3927 - 3954 |
|
~%
6-Chlornaphthal... CAS#:102153-63-9 |
| Literature: J. Gen. Chem. USSR (Engl. Transl.), , vol. 33, p. 664 - 667,658 - 660 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 6-Chloro-2-naphthyls |
| 6-Chloronaphthalene sulfonyl chloide |
| 6-Chloro-naphthalene-2-sulfonyl chloride |
| 6-chloronaphth-2-ylsulphonyl chloride |
| 6-Chloro-2-naphthalenesulfonyl chloride |
| 2-Naphthalenesulfonyl chloride, 6-chloro- |
| 6-Cloro-2-Naphthylsulfonyl Chlorid |
| 6-cloro-2-naphthylsulfonylchloride |
| 6-Chloro-2-Naphthylsulfonyl Chloride |
| 6-chloro-2-naphthylsulfonylchloride |
| 6-Chlornaphthalen-2-sulfonylchlorid |
| 6-chloronaphtalene-2-sulfonyl chloride |
| 6-CHLORO-2-NAPHTHYLSULFONYL CHLORIDE MIN |
| 6-chloronaphthalen-2-ylsulfonyl chloride |
| MFCD04037080 |
| 2-Chloro-6-naphthalenesulfonyl chloride |
| 6-Chloronaphthalene-2-sulfonyl chloride |