1,3-dimethyl-1,3-bis(trimethylsilyl)urea structure
|
Common Name | 1,3-dimethyl-1,3-bis(trimethylsilyl)urea | ||
|---|---|---|---|---|
| CAS Number | 10218-17-4 | Molecular Weight | 232.47100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H24N2OSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-dimethyl-1,3-bis(trimethylsilyl)urea |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H24N2OSi2 |
|---|---|
| Molecular Weight | 232.47100 |
| Exact Mass | 232.14300 |
| PSA | 23.55000 |
| LogP | 2.63980 |
| InChIKey | OZSLNVMOKRIJKG-UHFFFAOYSA-N |
| SMILES | CN(C(=O)N(C)[Si](C)(C)C)[Si](C)(C)C |
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | 22-38 |
| Safety Phrases | 36/37 |
| HS Code | 2931900090 |
|
~%
1,3-dimethyl-1,... CAS#:10218-17-4 |
| Literature: Journal of the American Chemical Society, , vol. 86, p. 4400 - 4406 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| N,N-Dimethyl-bistrimethyl-silyl-harnstoff |
| N,N'-Bis(trimethylsilyl)-N,N'-dimethylharnstoff |
| Urea,N,N'-dimethyl-N,N'-bis(trimethylsilyl) |
| Urea,1,3-dimethyl-1,3-bis(trimethylsilyl)-(7CI,8CI) |
| N,N'-Dimethyl-N,N'-bis(trimethylsilyl)harnstoff |
| N.N'-dimethyl-N.N'-bis(trimethylsilyl)urea |