(4-hydroxyphenyl)-[2-(4-hydroxyphenyl)-1-benzofuran-3-yl]methanone structure
|
Common Name | (4-hydroxyphenyl)-[2-(4-hydroxyphenyl)-1-benzofuran-3-yl]methanone | ||
|---|---|---|---|---|
| CAS Number | 102184-07-6 | Molecular Weight | 330.33300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-hydroxyphenyl)-[2-(4-hydroxyphenyl)-1-benzofuran-3-yl]methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H14O4 |
|---|---|
| Molecular Weight | 330.33300 |
| Exact Mass | 330.08900 |
| PSA | 70.67000 |
| LogP | 4.74200 |
| InChIKey | ISFTYVILLCOYSZ-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(O)cc1)c1c(-c2ccc(O)cc2)oc2ccccc12 |
|
~%
(4-hydroxypheny... CAS#:102184-07-6 |
| Literature: Durani; Jain; Saeed; Dikshit; Kapil Journal of Medicinal Chemistry, 1989 , vol. 32, # 8 p. 1700 - 1707 |
|
~%
(4-hydroxypheny... CAS#:102184-07-6 |
| Literature: Durani; Jain; Saeed; Dikshit; Kapil Journal of Medicinal Chemistry, 1989 , vol. 32, # 8 p. 1700 - 1707 |
|
~%
(4-hydroxypheny... CAS#:102184-07-6 |
| Literature: Durani; Jain; Saeed; Dikshit; Kapil Journal of Medicinal Chemistry, 1989 , vol. 32, # 8 p. 1700 - 1707 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| (4-hydroxy-phenyl)-[2-(4-hydroxy-phenyl)-benzofuran-3-yl]-methanone |
| Methanone,(4-hydroxyphenyl)[2-(4-hydroxyphenyl)-3-benzofuranyl] |
| 2-<4-Hydroxy-phenyl>-3-<4-hydroxy-benzoyl>-cumaron |