2-[N-methyl-4-(methylamino)-3-nitroanilino]ethanol structure
|
Common Name | 2-[N-methyl-4-(methylamino)-3-nitroanilino]ethanol | ||
|---|---|---|---|---|
| CAS Number | 10228-03-2 | Molecular Weight | 225.24400 | |
| Density | 1.303g/cm3 | Boiling Point | 430.1ºC at 760mmHg | |
| Molecular Formula | C10H15N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.9ºC | |
| Name | 2-[N-methyl-4-(methylamino)-3-nitroanilino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.303g/cm3 |
|---|---|
| Boiling Point | 430.1ºC at 760mmHg |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.24400 |
| Flash Point | 213.9ºC |
| Exact Mass | 225.11100 |
| PSA | 81.32000 |
| LogP | 1.66120 |
| Vapour Pressure | 3.67E-08mmHg at 25°C |
| Index of Refraction | 1.648 |
| InChIKey | WFQYZMBZJONURU-UHFFFAOYSA-N |
| SMILES | CNc1ccc(N(C)CCO)cc1[N+](=O)[O-] |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(Methyl(4-(methylamino)-3-nitrophenyl)amino)ethanol |
| N,N'-Dimethyl-N-hydroxyethyl-3-nitro-p-phenylenediamine |
| EINECS 233-549-1 |
| 2-(N-Methyl-4-(methylamino)-3-nitroanilino)ethanol |