2-[Methyl(4-nitrophenyl)amino]ethanol structure
|
Common Name | 2-[Methyl(4-nitrophenyl)amino]ethanol | ||
|---|---|---|---|---|
| CAS Number | 18226-16-9 | Molecular Weight | 196.203 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 374.9±27.0 °C at 760 mmHg | |
| Molecular Formula | C9H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.5±23.7 °C | |
| Name | 2-(N-methyl-4-nitroanilino)ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 374.9±27.0 °C at 760 mmHg |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.203 |
| Flash Point | 180.5±23.7 °C |
| Exact Mass | 196.084793 |
| PSA | 69.29000 |
| LogP | 1.85 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | BWUZCAZXFREZFN-UHFFFAOYSA-N |
| SMILES | CN(CCO)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2922199090 |
|---|
|
~%
2-[Methyl(4-nit... CAS#:18226-16-9 |
| Literature: Meo, Paolo Lo; D'Anna, Francesca; Gruttadauria, Michelangelo; Riela, Serena; Noto, Renato Tetrahedron, 2004 , vol. 60, # 41 p. 9099 - 9111 |
|
~%
2-[Methyl(4-nit... CAS#:18226-16-9 |
| Literature: Knipe,A.C.; Lound-Keast,J. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1976 , p. 1741 - 1748 |
|
~%
2-[Methyl(4-nit... CAS#:18226-16-9 |
| Literature: Knipe,A.C.; Lound-Keast,J. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1976 , p. 1741 - 1748 |
|
~%
2-[Methyl(4-nit... CAS#:18226-16-9 |
| Literature: Knipe, Anthony C.; Sridhar, Narayan; Lound-Keast, Joseph Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1984 , p. 1893 - 1900 |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-[Methyl(4-nitrophenyl)amino]ethanol |
| Ethanol, 2-[methyl(4-nitrophenyl)amino]- |
| 2-N-methyl-N-(p-nitrophenyl)aminoethanol |
| N-(2-hydroxyethyl)-N-methyl-4-nitroaniline |
| 4-nitro-[N-(2-hydroxyethyl)-N-methyl]aniline |
| <2-Hydroxy-aethyl>-<4-nitro-phenyl>-methyl-amin |
| 2-(Methyl(4-nitrophenyl)amino)ethanol |
| 2-[methyl(4-nitrophenyl)amino]ethan-1-ol |
| N-(2-Hydroxy-ethyl)-N-methyl-4-nitro-anilin |