1-(4-Methoxyphenyl)-2-phenylethanone structure
|
Common Name | 1-(4-Methoxyphenyl)-2-phenylethanone | ||
|---|---|---|---|---|
| CAS Number | 1023-17-2 | Molecular Weight | 226.270 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 380.0±17.0 °C at 760 mmHg | |
| Molecular Formula | C15H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.2±14.5 °C | |
| Name | 4-Methoxy-2-Phenylacetophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 380.0±17.0 °C at 760 mmHg |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.270 |
| Flash Point | 173.2±14.5 °C |
| Exact Mass | 226.099380 |
| PSA | 26.30000 |
| LogP | 3.25 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.570 |
| InChIKey | PLALKSRAHVYFOH-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)Cc2ccccc2)cc1 |
| Storage condition | Refrigerator |
| Hazard Codes | C |
|---|---|
| HS Code | 2914509090 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| MFCD00017177 |
| 1-(4-Methoxyphenyl)acetophenone |
| 4'-Methoxy-2-phenylacetophenone |
| 1-(4-Methoxyphenyl)-2-phenylethanone |
| Ethanone, 1-(4-methoxyphenyl)-2-phenyl- |