tert-butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate structure
|
Common Name | tert-butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1023595-19-8 | Molecular Weight | 254.368 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 354.1±35.0 °C at 760 mmHg | |
| Molecular Formula | C14H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.0±25.9 °C | |
| Name | 2,9-Diazaspiro[5.5]undecane-9-carboxylic acid tert-butyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 354.1±35.0 °C at 760 mmHg |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.368 |
| Flash Point | 168.0±25.9 °C |
| Exact Mass | 254.199432 |
| PSA | 41.57000 |
| LogP | 2.02 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | QDWTYWWOUAIWGI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCCNC2)CC1 |
| Storage condition | 2-8°C |
| HS Code | 2933990090 |
|---|
|
~%
tert-butyl 2,9-... CAS#:1023595-19-8 |
| Literature: WO2014/15495 A1, ; Page/Page column 36 ; |
|
~%
tert-butyl 2,9-... CAS#:1023595-19-8 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 24, # 2 p. 565 - 570 |
|
~%
tert-butyl 2,9-... CAS#:1023595-19-8 |
| Literature: WO2014/15495 A1, ; |
|
~%
tert-butyl 2,9-... CAS#:1023595-19-8 |
| Literature: WO2014/15495 A1, ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 9-Boc-2,9-diazaspiro[5.5]undecane |
| 2-Methyl-2-propanyl 2,9-diazaspiro[5.5]undecane-9-carboxylate |
| 2,9-Diazaspiro[5.5]undecane-9-carboxylic acid, 1,1-dimethylethyl ester |
| tert-Butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate |