1-Boc-4-piperidinemethanol structure
|
Common Name | 1-Boc-4-piperidinemethanol | ||
|---|---|---|---|---|
| CAS Number | 123855-51-6 | Molecular Weight | 215.29 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 308.0±15.0 °C at 760 mmHg | |
| Molecular Formula | C11H21NO3 | Melting Point | 78-82 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 140.1±20.4 °C | |
Use of 1-Boc-4-piperidinemethanolN-Boc-4-piperidinemethanol is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | N-Boc-4-piperidinemethanol |
|---|---|
| Synonym | More Synonyms |
| Description | N-Boc-4-piperidinemethanol is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 308.0±15.0 °C at 760 mmHg |
| Melting Point | 78-82 °C(lit.) |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 |
| Flash Point | 140.1±20.4 °C |
| Exact Mass | 215.152145 |
| PSA | 49.77000 |
| LogP | 0.88 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.479 |
| InChIKey | CTEDVGRUGMPBHE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CO)CC1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933399090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Synthesis and pharmacological evaluation of piperidinoalkanoyl-1,2,3,4-tetrahydroisoquinoline derivatives as novel specific bradycardic agents.
Bioorg. Med. Chem. Lett. 14 , 3049-3052, (2004) A series of piperidinoalkanoyl-1,2,3,4-tetrahydroisoquinoline derivatives were synthesized, and their bradycardic activities were investigated in the isolated right atria of guinea pigs and in conscio... |
| 1-(tert-Butoxycarbonyl)-4-piperidinemethanol |
| N-BOC-4-Piperidinemethanol |
| MFCD02094488 |
| N-tert-Butyloxycarbonyl-4-piperidinemethanol |
| 1-Piperidinecarboxylic acid, 4-(hydroxymethyl)-, 1,1-dimethylethyl ester |
| 1-Boc-4-(hydroxymethyl)piperidine |
| 2-Methyl-2-propanyl 4-(hydroxymethyl)-1-piperidinecarboxylate |
| 1-(tert-Butoxycarbonyl)-4-(hydroxymethyl)piperidine |
| tert-Butyl-4-(hydroxymethyl)piperidin-1-carboxylat |
| 1-Boc-4-piperidinemethanol |
| tert-butyl 4-(Hydroxymethyl)piperidine-1-carboxylate |
| N-(tert-Butoxycarbonyl)-4-piperidinemethanol |