N(alpha)-acetylglycyllysyl methyl ester structure
|
Common Name | N(alpha)-acetylglycyllysyl methyl ester | ||
|---|---|---|---|---|
| CAS Number | 10236-44-9 | Molecular Weight | 319.354 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H25N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N(alpha)-acetylglycyllysyl methyl esterAc-Gly-Lys-OMe is a substrate for urokinase. Ac-Gly-Lys-OMe can be used to measure the effects of small molecule inhibitors on urokinase activity[1]. |
| Name | Ac-Gly-Lys-OMe (acetate) |
|---|---|
| Synonym | More Synonyms |
| Description | Ac-Gly-Lys-OMe is a substrate for urokinase. Ac-Gly-Lys-OMe can be used to measure the effects of small molecule inhibitors on urokinase activity[1]. |
|---|---|
| Related Catalog | |
| Target |
urokinase[1] |
| References |
| Molecular Formula | C13H25N3O6 |
|---|---|
| Molecular Weight | 319.354 |
| Exact Mass | 319.174347 |
| InChIKey | FIGKGJVUYAFLBI-VIFPVBQESA-N |
| SMILES | COC(=O)C(CCCCN)NC(=O)CNC(C)=O |
| Ac-Gly-Lys-OMe (acetate) |
| L-Lysine, N-acetylglycyl-, methyl ester, acetate (1:1) |
| Methyl N-acetylglycyl-L-lysinate acetate (1:1) |