2-[(4-bromophenyl)methyl]-5-chloro-1,3-benzoxazole
![2-[(4-bromophenyl)methyl]-5-chloro-1,3-benzoxazole Structure](https://image.chemsrc.com/caspic/119/102394-37-6.png)
2-[(4-bromophenyl)methyl]-5-chloro-1,3-benzoxazole structure
|
Common Name | 2-[(4-bromophenyl)methyl]-5-chloro-1,3-benzoxazole | ||
|---|---|---|---|---|
| CAS Number | 102394-37-6 | Molecular Weight | 322.58400 | |
| Density | 1.557g/cm3 | Boiling Point | 430.1ºC at 760 mmHg | |
| Molecular Formula | C14H9BrClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[(4-bromophenyl)methyl]-5-chloro-1,3-benzoxazole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.557g/cm3 |
|---|---|
| Boiling Point | 430.1ºC at 760 mmHg |
| Molecular Formula | C14H9BrClNO |
| Molecular Weight | 322.58400 |
| Flash Point | 213.9ºC |
| Exact Mass | 320.95600 |
| PSA | 26.03000 |
| LogP | 4.83450 |
| Vapour Pressure | 3.35E-07mmHg at 25°C |
| Index of Refraction | 1.659 |
| InChIKey | UUCVQIQOMQYYQD-UHFFFAOYSA-N |
| SMILES | Clc1ccc2oc(Cc3ccc(Br)cc3)nc2c1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:95-85-2
CAS#:136350-66-8This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Ratio of CR50 for wild type Bacillus subtilis H17 to CR50 for recombination-deficient...
Source: ChEMBL
Target: Bacillus subtilis
External Id: CHEMBL3057586
|
|
Name: Genotoxicity in recombination-deficient Bacillus subtilis M45 assessed as growth inhi...
Source: ChEMBL
Target: Bacillus subtilis
External Id: CHEMBL3057587
|
|
Name: Antifungal activity against Candida albicans by serial dilution method
Source: ChEMBL
Target: Candida albicans
External Id: CHEMBL892428
|
|
Name: Genotoxicity in wild type Bacillus subtilis H17 assessed as growth inhibition
Source: ChEMBL
Target: Bacillus subtilis
External Id: CHEMBL3057588
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-(4-bromobenzyl)-5-chlorobenzoxazole |
| 2-(4-bromobenzyl)-5-chloro-1,3-benzoxazole |
| Benzoxazole,2-[(4-bromophenyl)methyl]-5-chloro |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2-[(4-bromophenyl)methyl]-5-chloro-1,3-benzoxazole? |
| A: LogP of 2-[(4-bromophenyl)methyl]-5-chloro-1,3-benzoxazole is 4.83450. |
| Q: What is the molecular formula of 2-[(4-bromophenyl)methyl]-5-chloro-1,3-benzoxazole? |
| A: Molecular formula of 2-[(4-bromophenyl)methyl]-5-chloro-1,3-benzoxazole is C14H9BrClNO. |
| Q: What is the English name of 2-[(4-bromophenyl)methyl]-5-chloro-1,3-benzoxazole? |
| A: The English name of 2-[(4-bromophenyl)methyl]-5-chloro-1,3-benzoxazole is 2-[(4-bromophenyl)methyl]-5-chloro-1,3-benzoxazole. |
| Q: What English synonyms does 2-[(4-bromophenyl)methyl]-5-chloro-1,3-benzoxazole have? |
| A: English synonyms of 2-[(4-bromophenyl)methyl]-5-chloro-1,3-benzoxazole: 2-(4-bromobenzyl)-5-chlorobenzoxazole, 2-(4-bromobenzyl)-5-chloro-1,3-benzoxazole, Benzoxazole,2-[(4-bromophenyl)methyl]-5-chloro. |
| Q: What is the SMILES notation of 2-[(4-bromophenyl)methyl]-5-chloro-1,3-benzoxazole? |
| A: SMILES notation of 2-[(4-bromophenyl)methyl]-5-chloro-1,3-benzoxazole is Clc1ccc2oc(Cc3ccc(Br)cc3)nc2c1. |
| Q: What are the upstream materials of 2-[(4-bromophenyl)methyl]-5-chloro-1,3-benzoxazole? |
| A: Related upstream materials(CAS) of 2-[(4-bromophenyl)methyl]-5-chloro-1,3-benzoxazole: 95-85-2;136350-66-8. |
| Q: What is the boiling point of 2-[(4-bromophenyl)methyl]-5-chloro-1,3-benzoxazole? |
| A: Boiling point of 2-[(4-bromophenyl)methyl]-5-chloro-1,3-benzoxazole is 430.1ºC at 760 mmHg. |
| Q: What is the InChIKey of 2-[(4-bromophenyl)methyl]-5-chloro-1,3-benzoxazole? |
| A: InChIKey of 2-[(4-bromophenyl)methyl]-5-chloro-1,3-benzoxazole is UUCVQIQOMQYYQD-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-[(4-bromophenyl)methyl]-5-chloro-1,3-benzoxazole? |
| A: Molecular weight of 2-[(4-bromophenyl)methyl]-5-chloro-1,3-benzoxazole is 322.58400. |
| Q: What is the Chinese name of 102394-37-6? |
| A: Chinese name of 102394-37-6 is 102394-37-6. |