1-(4-bromophenyl)-3-phenyl-3-phenylsulfanylpropan-1-one structure
|
Common Name | 1-(4-bromophenyl)-3-phenyl-3-phenylsulfanylpropan-1-one | ||
|---|---|---|---|---|
| CAS Number | 102468-79-1 | Molecular Weight | 397.32800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H17BrOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-bromophenyl)-3-phenyl-3-phenylsulfanylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H17BrOS |
|---|---|
| Molecular Weight | 397.32800 |
| Exact Mass | 396.01800 |
| PSA | 42.37000 |
| LogP | 6.55550 |
| InChIKey | KCTFSDICMCLBJE-UHFFFAOYSA-N |
| SMILES | O=C(CC(Sc1ccccc1)c1ccccc1)c1ccc(Br)cc1 |
|
~94%
1-(4-bromopheny... CAS#:102468-79-1 |
| Literature: Konduru, Naveen Kumar; Dey, Sunita; Sajid, Mohammad; Owais, Mohammad; Ahmed, Naseem European Journal of Medicinal Chemistry, 2013 , vol. 59, p. 23 - 30 |
|
~%
1-(4-bromopheny... CAS#:102468-79-1 |
| Literature: Davey; Gwilt Journal of the Chemical Society, 1957 , p. 1015 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-(4-Brom-phenyl)-3-phenyl-3-phenylmercapto-propan-1-on |
| 1-Propanone,1-(4-bromophenyl)-3-phenyl-3-(phenylthio) |
| 1-(4-bromophenyl)-3-phenyl-3-phenylsulfenylpropan-1-one |
| 1-(4-bromo-phenyl)-3-phenyl-3-phenylsulfanyl-propan-1-one |