2-Propen-1-one,1-(4-bromophenyl)-3-phenyl- structure
|
Common Name | 2-Propen-1-one,1-(4-bromophenyl)-3-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 2403-27-2 | Molecular Weight | 287.15100 | |
| Density | 1.393g/cm3 | Boiling Point | 402.2ºC at 760mmHg | |
| Molecular Formula | C15H11BrO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 82.4ºC | |
| Name | 4'-Bromochalcone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.393g/cm3 |
|---|---|
| Boiling Point | 402.2ºC at 760mmHg |
| Molecular Formula | C15H11BrO |
| Molecular Weight | 287.15100 |
| Flash Point | 82.4ºC |
| Exact Mass | 285.99900 |
| PSA | 17.07000 |
| LogP | 4.34520 |
| InChIKey | QMHDTKUBDZUMNH-IZZDOVSWSA-N |
| SMILES | O=C(C=Cc1ccccc1)c1ccc(Br)cc1 |
| HS Code | 2914700090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-(4-bromo-phenyl)-3-phenyl-propenone |
| 4'-Brom-chalkon |
| 4-Bromophenylstyryl ketone |
| (2E)-1-(4-bromophenyl)-3-phenylprop-2-en-1-one |
| 2-Propen-1-one,1-(4-bromophenyl)-3-phenyl |
| 1-(4-Bromophenyl)-3-phenyl-2-propen-1-one |
| 1-(4-bromophenyl)-3-phenylprop-2-en-1-one |
| Styryl(4-bromophenyl) ketone |
| 4'-bromo-chalcone |